C28H28FN5O2 — CID 66596644
2-[(2S)-2-[4-(2,3,3a,7a-tetrahydroindol-1-yl)phenyl]morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one (PubChem CID 66596644) has the molecular formula C28H28FN5O2 and a molecular weight of 485.56 g/mol. Its IUPAC name is 2-[(2S)-2-[4-(2,3,3a,7a-tetrahydroindol-1-yl)phenyl]morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one.
| Compound Name | 2-[(2S)-2-[4-(2,3,3a,7a-tetrahydroindol-1-yl)phenyl]morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 66596644 |
| Molecular Formula | C28H28FN5O2 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 2-[(2S)-2-[4-(2,3,3a,7a-tetrahydroindol-1-yl)phenyl]morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one |
| SMILES | Cn1c(N2CCO[C@@H](c3ccc(N4CCC5C=CC=CC54)cc3)C2)nc(-c2ccncc2F)cc1=O |
| InChI | InChI=1S/C28H28FN5O2/c1-32-27(35)16-24(22-10-12-30-17-23(22)29)31-28(32)33-14-15-36-26(18-33)20-6-8-21(9-7-20)34-13-11-19-4-2-3-5-25(19)34/h2-10,12,16-17,19,25-26H,11,13-15,18H2,1H3/t19?,25?,26-/m1/s1 |
| InChIKey | STDRBPMFDKKVRP-QWQODOGXSA-N |
| XLogP | 3.88 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|