C18H20O4 — CID 73055340
3-[2-hydroxy-5-(2-hydroxy-5-prop-2-enylphenyl)phenyl]propane-1,2-diol (PubChem CID 73055340) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 3-[2-hydroxy-5-(2-hydroxy-5-prop-2-enylphenyl)phenyl]propane-1,2-diol.
| Compound Name | 3-[2-hydroxy-5-(2-hydroxy-5-prop-2-enylphenyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 73055340 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-[2-hydroxy-5-(2-hydroxy-5-prop-2-enylphenyl)phenyl]propane-1,2-diol |
| SMILES | C=CCc1ccc(O)c(-c2ccc(O)c(CC(O)CO)c2)c1 |
| InChI | InChI=1S/C18H20O4/c1-2-3-12-4-6-18(22)16(8-12)13-5-7-17(21)14(9-13)10-15(20)11-19/h2,4-9,15,19-22H,1,3,10-11H2 |
| InChIKey | VYJFSROTGBEULZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|