C31H38N4O7 — CID 73056171
1-[3-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3-methoxyphenyl]-4,5-dimethoxyphenyl]-3-[2-methyl-4-(2-morpholin-4-ylethoxy)phenyl]urea (PubChem CID 73056171) has the molecular formula C31H38N4O7 and a molecular weight of 578.67 g/mol. Its IUPAC name is 1-[3-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3-methoxyphenyl]-4,5-dimethoxyphenyl]-3-[2-methyl-4-(2-morpholin-4-ylethoxy)phenyl]urea.
| Compound Name | 1-[3-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3-methoxyphenyl]-4,5-dimethoxyphenyl]-3-[2-methyl-4-(2-morpholin-4-ylethoxy)phenyl]urea |
|---|---|
| PubChem CID | 73056171 |
| Molecular Formula | C31H38N4O7 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 1-[3-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]-3-methoxyphenyl]-4,5-dimethoxyphenyl]-3-[2-methyl-4-(2-morpholin-4-ylethoxy)phenyl]urea |
| SMILES | COc1cc(-c2cc(NC(=O)Nc3ccc(OCCN4CCOCC4)cc3C)cc(OC)c2OC)ccc1/C(C)=N/O |
| InChI | InChI=1S/C31H38N4O7/c1-20-16-24(42-15-12-35-10-13-41-14-11-35)7-9-27(20)33-31(36)32-23-18-26(30(40-5)29(19-23)39-4)22-6-8-25(21(2)34-37)28(17-22)38-3/h6-9,16-19,37H,10-15H2,1-5H3,(H2,32,33,36)/b34-21+ |
| InChIKey | MZJLETJONIHOIL-KEIPNQJHSA-N |
| XLogP | 5.24 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|