C31H37N3O7 — CID 73055004
1-[3-(4-acetyl-3-methoxyphenyl)-4,5-dimethoxyphenyl]-3-[4-(3-morpholin-4-ylpropoxy)phenyl]urea (PubChem CID 73055004) has the molecular formula C31H37N3O7 and a molecular weight of 563.65 g/mol. Its IUPAC name is 1-[3-(4-acetyl-3-methoxyphenyl)-4,5-dimethoxyphenyl]-3-[4-(3-morpholin-4-ylpropoxy)phenyl]urea.
| Compound Name | 1-[3-(4-acetyl-3-methoxyphenyl)-4,5-dimethoxyphenyl]-3-[4-(3-morpholin-4-ylpropoxy)phenyl]urea |
|---|---|
| PubChem CID | 73055004 |
| Molecular Formula | C31H37N3O7 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | 1-[3-(4-acetyl-3-methoxyphenyl)-4,5-dimethoxyphenyl]-3-[4-(3-morpholin-4-ylpropoxy)phenyl]urea |
| SMILES | COc1cc(-c2cc(NC(=O)Nc3ccc(OCCCN4CCOCC4)cc3)cc(OC)c2OC)ccc1C(C)=O |
| InChI | InChI=1S/C31H37N3O7/c1-21(35)26-11-6-22(18-28(26)37-2)27-19-24(20-29(38-3)30(27)39-4)33-31(36)32-23-7-9-25(10-8-23)41-15-5-12-34-13-16-40-17-14-34/h6-11,18-20H,5,12-17H2,1-4H3,(H2,32,33,36) |
| InChIKey | ILQUOUXLZAXLDK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|