About 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol
5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol (PubChem CID 73056720) has the molecular formula C22H22F4O2S2
and a molecular weight of 458.54 g/mol. Its IUPAC name is 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol.
Molecular Properties
| Compound Name | 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol |
| PubChem CID | 73056720 |
| Molecular Formula | C22H22F4O2S2 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol |
| SMILES | C=CCCC1(C(F)(F)Sc2ccccc2)CCC(O)(C(F)(F)Sc2ccccc2)O1 |
| InChI | InChI=1S/C22H22F4O2S2/c1-2-3-14-19(21(23,24)29-17-10-6-4-7-11-17)15-16-20(27,28-19)22(25,26)30-18-12-8-5-9-13-18/h2,4-13,27H,1,3,14-16H2 |
| InChIKey | IRTSAHAPGUNBCZ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol?
The IUPAC name of 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol (CID 73056720) is 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol.
What is the SMILES notation for 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol?
The canonical SMILES for 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol is C=CCCC1(C(F)(F)Sc2ccccc2)CCC(O)(C(F)(F)Sc2ccccc2)O1.
What is the InChIKey of 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol?
The InChIKey is IRTSAHAPGUNBCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F4O2S2/c1-2-3-14-19(21(23,24)29-17-10-6-4-7-11-17)15-16-20(27,28-19)22(25,26)30-18-12-8-5-9-13-18/h2,4-13,27H,1,3,14-16H2.
What are the key properties of 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol?
5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol has a molecular weight of 458.54 g/mol, XLogP of 6.96, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-enyl-2,5-bis[difluoro(phenylsulfanyl)methyl]oxolan-2-ol is sourced from PubChem (CID 73056720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).