C14H16F4OS — CID 54771880
1-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)cyclohexan-1-ol (PubChem CID 54771880) has the molecular formula C14H16F4OS and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)cyclohexan-1-ol.
| Compound Name | 1-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 54771880 |
| Molecular Formula | C14H16F4OS |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)cyclohexan-1-ol |
| SMILES | OC1(C(F)(F)C(F)(F)Sc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C14H16F4OS/c15-13(16,12(19)9-5-2-6-10-12)14(17,18)20-11-7-3-1-4-8-11/h1,3-4,7-8,19H,2,5-6,9-10H2 |
| InChIKey | OWSOYJUCRVWOEL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|