C16H32O4Si — CID 73056735
(4S,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde (PubChem CID 73056735) has the molecular formula C16H32O4Si and a molecular weight of 316.51 g/mol. Its IUPAC name is (4S,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4S,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 73056735 |
| Molecular Formula | C16H32O4Si |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (4S,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxybutyl]-2,2-dimethyl-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1C=O |
| InChI | InChI=1S/C16H32O4Si/c1-9-10-12(20-21(7,8)15(2,3)4)14-13(11-17)18-16(5,6)19-14/h11-14H,9-10H2,1-8H3/t12-,13-,14-/m1/s1 |
| InChIKey | OGVIWCUROHJGNE-MGPQQGTHSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|