About (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate
(2-oxo-1H-quinolin-4-yl) 4-methylbenzoate (PubChem CID 73056961) has the molecular formula C17H13NO3
and a molecular weight of 279.30 g/mol. Its IUPAC name is (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate.
Molecular Properties
| Compound Name | (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate |
| PubChem CID | 73056961 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cc(=O)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C17H13NO3/c1-11-6-8-12(9-7-11)17(20)21-15-10-16(19)18-14-5-3-2-4-13(14)15/h2-10H,1H3,(H,18,19) |
| InChIKey | TVKCCZMVVASGAR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate?
The IUPAC name of (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate (CID 73056961) is (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate.
What is the SMILES notation for (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate?
The canonical SMILES for (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate is Cc1ccc(C(=O)Oc2cc(=O)[nH]c3ccccc23)cc1.
What is the InChIKey of (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate?
The InChIKey is TVKCCZMVVASGAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3/c1-11-6-8-12(9-7-11)17(20)21-15-10-16(19)18-14-5-3-2-4-13(14)15/h2-10H,1H3,(H,18,19).
What are the key properties of (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate?
(2-oxo-1H-quinolin-4-yl) 4-methylbenzoate has a molecular weight of 279.30 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-1H-quinolin-4-yl) 4-methylbenzoate is sourced from PubChem (CID 73056961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).