C16H19NO4 — CID 171905311
4-(6,6-dihydroxy-3-methylhex-1-en-2-yl)oxy-1H-quinolin-2-one (PubChem CID 171905311) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-(6,6-dihydroxy-3-methylhex-1-en-2-yl)oxy-1H-quinolin-2-one.
| Compound Name | 4-(6,6-dihydroxy-3-methylhex-1-en-2-yl)oxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 171905311 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-(6,6-dihydroxy-3-methylhex-1-en-2-yl)oxy-1H-quinolin-2-one |
| SMILES | C=C(Oc1cc(=O)[nH]c2ccccc12)C(C)CCC(O)O |
| InChI | InChI=1S/C16H19NO4/c1-10(7-8-16(19)20)11(2)21-14-9-15(18)17-13-6-4-3-5-12(13)14/h3-6,9-10,16,19-20H,2,7-8H2,1H3,(H,17,18) |
| InChIKey | DFCILYWDCWPGJM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|