C15H23N4O3+ — CID 73066226
3-methyl-1-(5-oxohexyl)-7-propyl-5H-purin-7-ium-2,6-dione (PubChem CID 73066226) has the molecular formula C15H23N4O3+ and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-methyl-1-(5-oxohexyl)-7-propyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 3-methyl-1-(5-oxohexyl)-7-propyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 73066226 |
| Molecular Formula | C15H23N4O3+ |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 3-methyl-1-(5-oxohexyl)-7-propyl-5H-purin-7-ium-2,6-dione |
| SMILES | CCC[N+]1=CN=C2C1C(=O)N(CCCCC(C)=O)C(=O)N2C |
| InChI | InChI=1S/C15H23N4O3/c1-4-8-18-10-16-13-12(18)14(21)19(15(22)17(13)3)9-6-5-7-11(2)20/h10,12H,4-9H2,1-3H3/q+1 |
| InChIKey | POGISAMZFLRXFN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|