C30H44O4 — CID 73067936
7-hydroxy-3-(10-hydroxy-6,10-dimethyl-3-oxoundeca-4,6,8-trien-2-ylidene)-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one (PubChem CID 73067936) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is 7-hydroxy-3-(10-hydroxy-6,10-dimethyl-3-oxoundeca-4,6,8-trien-2-ylidene)-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one.
| Compound Name | 7-hydroxy-3-(10-hydroxy-6,10-dimethyl-3-oxoundeca-4,6,8-trien-2-ylidene)-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one |
|---|---|
| PubChem CID | 73067936 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 7-hydroxy-3-(10-hydroxy-6,10-dimethyl-3-oxoundeca-4,6,8-trien-2-ylidene)-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one |
| SMILES | CC(C=CC(=O)C(C)=C1C(=O)CC2C1(C)CCC1C(C)(C)C(O)CCC21C)=CC=CC(C)(C)O |
| InChI | InChI=1S/C30H44O4/c1-19(10-9-15-27(3,4)34)11-12-21(31)20(2)26-22(32)18-24-29(7)17-14-25(33)28(5,6)23(29)13-16-30(24,26)8/h9-12,15,23-25,33-34H,13-14,16-18H2,1-8H3 |
| InChIKey | BTJFRFDIAUJHFQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|