C30H44O5 — CID 74392977
7-hydroxy-3-(10-hydroxy-6,10-dimethyl-3-oxoundeca-4,6,8-trien-2-ylidene)-6-(hydroxymethyl)-3a,6,9a-trimethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one (PubChem CID 74392977) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is 7-hydroxy-3-(10-hydroxy-6,10-dimethyl-3-oxoundeca-4,6,8-trien-2-ylidene)-6-(hydroxymethyl)-3a,6,9a-trimethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one.
| Compound Name | 7-hydroxy-3-(10-hydroxy-6,10-dimethyl-3-oxoundeca-4,6,8-trien-2-ylidene)-6-(hydroxymethyl)-3a,6,9a-trimethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one |
|---|---|
| PubChem CID | 74392977 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 7-hydroxy-3-(10-hydroxy-6,10-dimethyl-3-oxoundeca-4,6,8-trien-2-ylidene)-6-(hydroxymethyl)-3a,6,9a-trimethyl-1,4,5,5a,7,8,9,9b-octahydrocyclopenta[a]naphthalen-2-one |
| SMILES | CC(C=CC(=O)C(C)=C1C(=O)CC2C1(C)CCC1C(C)(CO)C(O)CCC21C)=CC=CC(C)(C)O |
| InChI | InChI=1S/C30H44O5/c1-19(9-8-14-27(3,4)35)10-11-21(32)20(2)26-22(33)17-24-28(5)16-13-25(34)30(7,18-31)23(28)12-15-29(24,26)6/h8-11,14,23-25,31,34-35H,12-13,15-18H2,1-7H3 |
| InChIKey | PLALDLPGLFATBK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|