C23H24ClN3O — CID 7306865
2-(butylamino)-1-[(4R)-4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]ethanone (PubChem CID 7306865) has the molecular formula C23H24ClN3O and a molecular weight of 393.92 g/mol. Its IUPAC name is 2-(butylamino)-1-[(4R)-4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]ethanone.
| Compound Name | 2-(butylamino)-1-[(4R)-4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]ethanone |
|---|---|
| PubChem CID | 7306865 |
| Molecular Formula | C23H24ClN3O |
| Molecular Weight | 393.92 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-(butylamino)-1-[(4R)-4-(4-chlorophenyl)-4H-pyrrolo[1,2-a]quinoxalin-5-yl]ethanone |
| SMILES | CCCCNCC(=O)N1c2ccccc2-n2cccc2[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClN3O/c1-2-3-14-25-16-22(28)27-20-8-5-4-7-19(20)26-15-6-9-21(26)23(27)17-10-12-18(24)13-11-17/h4-13,15,23,25H,2-3,14,16H2,1H3/t23-/m1/s1 |
| InChIKey | YICIOWWMICPRAR-HSZRJFAPSA-N |
| XLogP | 4.96 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.92 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|