C17H23F3O3 — CID 73069506
1-but-3-enyl-7-methyl-4-propan-2-yl-4-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 73069506) has the molecular formula C17H23F3O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-but-3-enyl-7-methyl-4-propan-2-yl-4-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | 1-but-3-enyl-7-methyl-4-propan-2-yl-4-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 73069506 |
| Molecular Formula | C17H23F3O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-but-3-enyl-7-methyl-4-propan-2-yl-4-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C=CCCC12CC(=O)C(OCC(F)(F)F)(C(C)C)C(C=C1C)O2 |
| InChI | InChI=1S/C17H23F3O3/c1-5-6-7-15-9-13(21)17(11(2)3,22-10-16(18,19)20)14(23-15)8-12(15)4/h5,8,11,14H,1,6-7,9-10H2,2-4H3 |
| InChIKey | YXMZOSRRZPLSFO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|