C17H22ClF3O3 — CID 73016245
1-but-3-enyl-2-chloro-7-methyl-4-propan-2-yl-4-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 73016245) has the molecular formula C17H22ClF3O3 and a molecular weight of 366.81 g/mol. Its IUPAC name is 1-but-3-enyl-2-chloro-7-methyl-4-propan-2-yl-4-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | 1-but-3-enyl-2-chloro-7-methyl-4-propan-2-yl-4-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 73016245 |
| Molecular Formula | C17H22ClF3O3 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-but-3-enyl-2-chloro-7-methyl-4-propan-2-yl-4-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C=CCCC12OC(C=C1C)C(OCC(F)(F)F)(C(C)C)C(=O)C2Cl |
| InChI | InChI=1S/C17H22ClF3O3/c1-5-6-7-15-11(4)8-12(24-15)17(10(2)3,14(22)13(15)18)23-9-16(19,20)21/h5,8,10,12-13H,1,6-7,9H2,2-4H3 |
| InChIKey | SKSGCXMRNUUGGL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|