C15H20Cl2O2 — CID 11695160
(1R,2S,5S)-1-but-3-enyl-2,4-dichloro-7-methyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 11695160) has the molecular formula C15H20Cl2O2 and a molecular weight of 303.23 g/mol. Its IUPAC name is (1R,2S,5S)-1-but-3-enyl-2,4-dichloro-7-methyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2S,5S)-1-but-3-enyl-2,4-dichloro-7-methyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 11695160 |
| Molecular Formula | C15H20Cl2O2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (1R,2S,5S)-1-but-3-enyl-2,4-dichloro-7-methyl-4-propan-2-yl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C=CCC[C@@]12O[C@@H](C=C1C)C(Cl)(C(C)C)C(=O)[C@H]2Cl |
| InChI | InChI=1S/C15H20Cl2O2/c1-5-6-7-14-10(4)8-11(19-14)15(17,9(2)3)13(18)12(14)16/h5,8-9,11-12H,1,6-7H2,2-4H3/t11-,12+,14+,15?/m0/s1 |
| InChIKey | VDOPAJROVFUJIY-KCGXDXBQSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|