C12H14ClF3O3 — CID 11716364
(1R,2R,4R,5S)-4-chloro-2-propan-2-yl-2-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 11716364) has the molecular formula C12H14ClF3O3 and a molecular weight of 298.69 g/mol. Its IUPAC name is (1R,2R,4R,5S)-4-chloro-2-propan-2-yl-2-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2R,4R,5S)-4-chloro-2-propan-2-yl-2-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 11716364 |
| Molecular Formula | C12H14ClF3O3 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (1R,2R,4R,5S)-4-chloro-2-propan-2-yl-2-(2,2,2-trifluoroethoxy)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC(C)[C@]1(OCC(F)(F)F)C(=O)[C@H](Cl)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C12H14ClF3O3/c1-6(2)12(18-5-11(14,15)16)8-4-3-7(19-8)9(13)10(12)17/h3-4,6-9H,5H2,1-2H3/t7-,8+,9+,12+/m0/s1 |
| InChIKey | JSERNYOLLWPTFM-FNOROQBZSA-N |
| XLogP | 2.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|