C9H11ClO2 — CID 13167302
(1R,2S,4R,5S)-4-chloro-1,2-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 13167302) has the molecular formula C9H11ClO2 and a molecular weight of 186.64 g/mol. Its IUPAC name is (1R,2S,4R,5S)-4-chloro-1,2-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2S,4R,5S)-4-chloro-1,2-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 13167302 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | (1R,2S,4R,5S)-4-chloro-1,2-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C[C@@H]1C(=O)[C@H](Cl)[C@@H]2C=C[C@@]1(C)O2 |
| InChI | InChI=1S/C9H11ClO2/c1-5-8(11)7(10)6-3-4-9(5,2)12-6/h3-7H,1-2H3/t5-,6+,7-,9-/m1/s1 |
| InChIKey | DKYYJPLBQZTTAT-JVZYCSMKSA-N |
| XLogP | 1.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|