C15H21NO — CID 73079214
1,3,3-trimethyl-2-pyridin-2-ylbicyclo[2.2.1]heptan-2-ol (PubChem CID 73079214) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-pyridin-2-ylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | 1,3,3-trimethyl-2-pyridin-2-ylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 73079214 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1,3,3-trimethyl-2-pyridin-2-ylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC12CCC(C1)C(C)(C)C2(O)c1ccccn1 |
| InChI | InChI=1S/C15H21NO/c1-13(2)11-7-8-14(3,10-11)15(13,17)12-6-4-5-9-16-12/h4-6,9,11,17H,7-8,10H2,1-3H3 |
| InChIKey | OZEUZKGNVGYHPN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |