C17H15N4O2S- — CID 7308191
(3R)-3-(4-methylphenyl)-3-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanoate (PubChem CID 7308191) has the molecular formula C17H15N4O2S- and a molecular weight of 339.40 g/mol. Its IUPAC name is (3R)-3-(4-methylphenyl)-3-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanoate.
| Compound Name | (3R)-3-(4-methylphenyl)-3-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanoate |
|---|---|
| PubChem CID | 7308191 |
| Molecular Formula | C17H15N4O2S- |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (3R)-3-(4-methylphenyl)-3-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanoate |
| SMILES | Cc1ccc([C@@H](CC(=O)[O-])n2c(-c3ccncc3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C17H16N4O2S/c1-11-2-4-12(5-3-11)14(10-15(22)23)21-16(19-20-17(21)24)13-6-8-18-9-7-13/h2-9,14H,10H2,1H3,(H,20,24)(H,22,23)/p-1/t14-/m1/s1 |
| InChIKey | AZTPHVZOMDPAHG-CQSZACIVSA-M |
| XLogP | 2.04 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|