C14H10N4OS — CID 146138374
phenyl-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methanone (PubChem CID 146138374) has the molecular formula C14H10N4OS and a molecular weight of 282.33 g/mol. Its IUPAC name is phenyl-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methanone.
| Compound Name | phenyl-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 146138374 |
| Molecular Formula | C14H10N4OS |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | phenyl-(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methanone |
| SMILES | O=C(c1ccccc1)n1c(-c2ccncc2)n[nH]c1=S |
| InChI | InChI=1S/C14H10N4OS/c19-13(11-4-2-1-3-5-11)18-12(16-17-14(18)20)10-6-8-15-9-7-10/h1-9H,(H,17,20) |
| InChIKey | SANVXTYOKNSIOM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|