C18H11ClN4OS — CID 172564066
(4-chlorophenyl)-(3-quinolin-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methanone (PubChem CID 172564066) has the molecular formula C18H11ClN4OS and a molecular weight of 366.83 g/mol. Its IUPAC name is (4-chlorophenyl)-(3-quinolin-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methanone.
| Compound Name | (4-chlorophenyl)-(3-quinolin-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methanone |
|---|---|
| PubChem CID | 172564066 |
| Molecular Formula | C18H11ClN4OS |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (4-chlorophenyl)-(3-quinolin-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)n1c(-c2ccc3ccccc3n2)n[nH]c1=S |
| InChI | InChI=1S/C18H11ClN4OS/c19-13-8-5-12(6-9-13)17(24)23-16(21-22-18(23)25)15-10-7-11-3-1-2-4-14(11)20-15/h1-10H,(H,22,25) |
| InChIKey | MVTSTIPYDSUUKS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|