C20H16N4O2S — CID 175199508
1-(3-quinolin-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl benzoate (PubChem CID 175199508) has the molecular formula C20H16N4O2S and a molecular weight of 376.44 g/mol. Its IUPAC name is 1-(3-quinolin-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl benzoate.
| Compound Name | 1-(3-quinolin-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl benzoate |
|---|---|
| PubChem CID | 175199508 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-(3-quinolin-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)ethyl benzoate |
| SMILES | CC(OC(=O)c1ccccc1)n1c(-c2ccc3ccccc3n2)n[nH]c1=S |
| InChI | InChI=1S/C20H16N4O2S/c1-13(26-19(25)15-8-3-2-4-9-15)24-18(22-23-20(24)27)17-12-11-14-7-5-6-10-16(14)21-17/h2-13H,1H3,(H,23,27) |
| InChIKey | XYDORHRJAFTVLC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|