C29H32O8S — CID 73086019
2-(benzenesulfonylmethyl)-6-methoxy-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 73086019) has the molecular formula C29H32O8S and a molecular weight of 540.63 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-6-methoxy-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | 2-(benzenesulfonylmethyl)-6-methoxy-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 73086019 |
| Molecular Formula | C29H32O8S |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-6-methoxy-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | COC1OC2COC(CS(=O)(=O)c3ccccc3)OC2C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H32O8S/c1-32-29-28(35-18-22-13-7-3-8-14-22)27(34-17-21-11-5-2-6-12-21)26-24(36-29)19-33-25(37-26)20-38(30,31)23-15-9-4-10-16-23/h2-16,24-29H,17-20H2,1H3 |
| InChIKey | ZAJBIJVVVZTBLB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |