C28H27F3O8S — CID 135030861
[(6R,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] trifluoromethanesulfonate (PubChem CID 135030861) has the molecular formula C28H27F3O8S and a molecular weight of 580.58 g/mol. Its IUPAC name is [(6R,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] trifluoromethanesulfonate.
| Compound Name | [(6R,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135030861 |
| Molecular Formula | C28H27F3O8S |
| Molecular Weight | 580.58 g/mol |
| Exact Mass | 580.14 |
| IUPAC Name | [(6R,8aR)-2-phenyl-7,8-bis(phenylmethoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(O[C@H]1OC2COC(c3ccccc3)O[C@H]2C(OCc2ccccc2)C1OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H27F3O8S/c29-28(30,31)40(32,33)39-27-25(35-17-20-12-6-2-7-13-20)24(34-16-19-10-4-1-5-11-19)23-22(37-27)18-36-26(38-23)21-14-8-3-9-15-21/h1-15,22-27H,16-18H2/t22?,23-,24?,25?,26?,27-/m1/s1 |
| InChIKey | BJFHTRUXVOCTBM-AAVRZYPMSA-N |
| XLogP | 4.86 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|