C14H14N2O3S — CID 730870
ethyl 2-(2-benzamido-1,3-thiazol-5-yl)acetate (PubChem CID 730870) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is ethyl 2-(2-benzamido-1,3-thiazol-5-yl)acetate.
| Compound Name | ethyl 2-(2-benzamido-1,3-thiazol-5-yl)acetate |
|---|---|
| PubChem CID | 730870 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | ethyl 2-(2-benzamido-1,3-thiazol-5-yl)acetate |
| SMILES | CCOC(=O)Cc1cnc(NC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C14H14N2O3S/c1-2-19-12(17)8-11-9-15-14(20-11)16-13(18)10-6-4-3-5-7-10/h3-7,9H,2,8H2,1H3,(H,15,16,18) |
| InChIKey | AIOLYWIAVAVRPW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |