C16H13FN3O5- — CID 7308981
2-ethoxy-6-[(Z)-[(2-fluorobenzoyl)hydrazinylidene]methyl]-4-nitrophenolate (PubChem CID 7308981) has the molecular formula C16H13FN3O5- and a molecular weight of 346.29 g/mol. Its IUPAC name is 2-ethoxy-6-[(Z)-[(2-fluorobenzoyl)hydrazinylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-ethoxy-6-[(Z)-[(2-fluorobenzoyl)hydrazinylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7308981 |
| Molecular Formula | C16H13FN3O5- |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-ethoxy-6-[(Z)-[(2-fluorobenzoyl)hydrazinylidene]methyl]-4-nitrophenolate |
| SMILES | CCOc1cc([N+](=O)[O-])cc(/C=N\NC(=O)c2ccccc2F)c1[O-] |
| InChI | InChI=1S/C16H14FN3O5/c1-2-25-14-8-11(20(23)24)7-10(15(14)21)9-18-19-16(22)12-5-3-4-6-13(12)17/h3-9,21H,2H2,1H3,(H,19,22)/p-1/b18-9- |
| InChIKey | ATMVULPOERCOFS-NVMNQCDNSA-M |
| XLogP | 1.97 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|