C14H18N3O6- — CID 7341344
2-ethoxy-6-[(Z)-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]-4-nitrophenolate (PubChem CID 7341344) has the molecular formula C14H18N3O6- and a molecular weight of 324.31 g/mol. Its IUPAC name is 2-ethoxy-6-[(Z)-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-ethoxy-6-[(Z)-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7341344 |
| Molecular Formula | C14H18N3O6- |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-ethoxy-6-[(Z)-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]methyl]-4-nitrophenolate |
| SMILES | CCOc1cc([N+](=O)[O-])cc(/C=N\NC(=O)OC(C)(C)C)c1[O-] |
| InChI | InChI=1S/C14H19N3O6/c1-5-22-11-7-10(17(20)21)6-9(12(11)18)8-15-16-13(19)23-14(2,3)4/h6-8,18H,5H2,1-4H3,(H,16,19)/p-1/b15-8- |
| InChIKey | YGEIVTLAGUBVQE-NVNXTCNLSA-M |
| XLogP | 1.93 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|