C15H22O4 — CID 73097275
2-[2-formyl-4-methyl-3-(3-oxobutyl)cyclohexyl]prop-2-enoic acid (PubChem CID 73097275) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[2-formyl-4-methyl-3-(3-oxobutyl)cyclohexyl]prop-2-enoic acid.
| Compound Name | 2-[2-formyl-4-methyl-3-(3-oxobutyl)cyclohexyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 73097275 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[2-formyl-4-methyl-3-(3-oxobutyl)cyclohexyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1CCC(C)C(CCC(C)=O)C1C=O |
| InChI | InChI=1S/C15H22O4/c1-9-4-6-13(11(3)15(18)19)14(8-16)12(9)7-5-10(2)17/h8-9,12-14H,3-7H2,1-2H3,(H,18,19) |
| InChIKey | ZUVZYHLJLPPRFY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|