C35H66N4O3 — CID 73107984
1,13-bis(2-methylbutanoyl)-8-undec-2-enyl-1,5,9,13-tetrazacyclooctadecan-6-one (PubChem CID 73107984) has the molecular formula C35H66N4O3 and a molecular weight of 590.94 g/mol. Its IUPAC name is 1,13-bis(2-methylbutanoyl)-8-undec-2-enyl-1,5,9,13-tetrazacyclooctadecan-6-one.
| Compound Name | 1,13-bis(2-methylbutanoyl)-8-undec-2-enyl-1,5,9,13-tetrazacyclooctadecan-6-one |
|---|---|
| PubChem CID | 73107984 |
| Molecular Formula | C35H66N4O3 |
| Molecular Weight | 590.94 g/mol |
| Exact Mass | 590.51 |
| IUPAC Name | 1,13-bis(2-methylbutanoyl)-8-undec-2-enyl-1,5,9,13-tetrazacyclooctadecan-6-one |
| SMILES | CCCCCCCCC=CCC1CC(=O)NCCCN(C(=O)C(C)CC)CCCCCN(C(=O)C(C)CC)CCCN1 |
| InChI | InChI=1S/C35H66N4O3/c1-6-9-10-11-12-13-14-15-17-22-32-29-33(40)37-24-21-28-39(35(42)31(5)8-3)26-19-16-18-25-38(27-20-23-36-32)34(41)30(4)7-2/h15,17,30-32,36H,6-14,16,18-29H2,1-5H3,(H,37,40) |
| InChIKey | BBWSMYSNDAJELT-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.94 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|