C23H19NO2 — CID 7311788
(2S)-6-methyl-2,3,5-triphenyl-2H-1,3-oxazin-4-one (PubChem CID 7311788) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is (2S)-6-methyl-2,3,5-triphenyl-2H-1,3-oxazin-4-one.
| Compound Name | (2S)-6-methyl-2,3,5-triphenyl-2H-1,3-oxazin-4-one |
|---|---|
| PubChem CID | 7311788 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (2S)-6-methyl-2,3,5-triphenyl-2H-1,3-oxazin-4-one |
| SMILES | CC1=C(c2ccccc2)C(=O)N(c2ccccc2)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C23H19NO2/c1-17-21(18-11-5-2-6-12-18)22(25)24(20-15-9-4-10-16-20)23(26-17)19-13-7-3-8-14-19/h2-16,23H,1H3/t23-/m0/s1 |
| InChIKey | KOWLVLGMIJSAMF-QHCPKHFHSA-N |
| XLogP | 5.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |