About 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate
4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 73135916) has the molecular formula C9H9O5-
and a molecular weight of 197.17 g/mol. Its IUPAC name is 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate.
Analyze 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate?
The IUPAC name of 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate (CID 73135916) is 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate.
What is the SMILES notation for 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate?
The canonical SMILES for 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate is O=C([O-])C1C2CCC3(COC(=O)C13)O2.
What is the InChIKey of 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate?
The InChIKey is ZTNJBIVXMUDZMQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10O5/c10-7(11)5-4-1-2-9(14-4)3-13-8(12)6(5)9/h4-6H,1-3H2,(H,10,11)/p-1.
What are the key properties of 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate?
4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate has a molecular weight of 197.17 g/mol, XLogP of -1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3,10-dioxatricyclo[5.2.1.01,5]decane-6-carboxylate is sourced from PubChem (CID 73135916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).