C16H26NO4+ — CID 7313606
[(2R)-2-(3,4-dimethoxybenzoyl)oxypropyl]-diethylazanium (PubChem CID 7313606) has the molecular formula C16H26NO4+ and a molecular weight of 296.39 g/mol. Its IUPAC name is [(2R)-2-(3,4-dimethoxybenzoyl)oxypropyl]-diethylazanium.
| Compound Name | [(2R)-2-(3,4-dimethoxybenzoyl)oxypropyl]-diethylazanium |
|---|---|
| PubChem CID | 7313606 |
| Molecular Formula | C16H26NO4+ |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | [(2R)-2-(3,4-dimethoxybenzoyl)oxypropyl]-diethylazanium |
| SMILES | CC[NH+](CC)C[C@@H](C)OC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H25NO4/c1-6-17(7-2)11-12(3)21-16(18)13-8-9-14(19-4)15(10-13)20-5/h8-10,12H,6-7,11H2,1-5H3/p+1/t12-/m1/s1 |
| InChIKey | VWMLZFLHOTVGEL-GFCCVEGCSA-O |
| XLogP | 1.17 |
| TPSA | 49.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |