C23H25N5O4 — CID 73139587
1-benzoyl-N-(2-oxopiperidin-3-yl)-4-(pyridine-3-carbonyl)piperazine-2-carboxamide (PubChem CID 73139587) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is 1-benzoyl-N-(2-oxopiperidin-3-yl)-4-(pyridine-3-carbonyl)piperazine-2-carboxamide.
| Compound Name | 1-benzoyl-N-(2-oxopiperidin-3-yl)-4-(pyridine-3-carbonyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 73139587 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 1-benzoyl-N-(2-oxopiperidin-3-yl)-4-(pyridine-3-carbonyl)piperazine-2-carboxamide |
| SMILES | O=C1NCCCC1NC(=O)C1CN(C(=O)c2cccnc2)CCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H25N5O4/c29-20-18(9-5-11-25-20)26-21(30)19-15-27(22(31)17-8-4-10-24-14-17)12-13-28(19)23(32)16-6-2-1-3-7-16/h1-4,6-8,10,14,18-19H,5,9,11-13,15H2,(H,25,29)(H,26,30) |
| InChIKey | HKZBXJWWJXLVRH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |