C16H22N5O3+ — CID 9423865
(2S)-N-[(3S)-2-oxopiperidin-3-yl]-4-(pyridine-3-carbonyl)piperazin-1-ium-2-carboxamide (PubChem CID 9423865) has the molecular formula C16H22N5O3+ and a molecular weight of 332.38 g/mol. Its IUPAC name is (2S)-N-[(3S)-2-oxopiperidin-3-yl]-4-(pyridine-3-carbonyl)piperazin-1-ium-2-carboxamide.
| Compound Name | (2S)-N-[(3S)-2-oxopiperidin-3-yl]-4-(pyridine-3-carbonyl)piperazin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 9423865 |
| Molecular Formula | C16H22N5O3+ |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (2S)-N-[(3S)-2-oxopiperidin-3-yl]-4-(pyridine-3-carbonyl)piperazin-1-ium-2-carboxamide |
| SMILES | O=C1NCCC[C@@H]1NC(=O)[C@@H]1CN(C(=O)c2cccnc2)CC[NH2+]1 |
| InChI | InChI=1S/C16H21N5O3/c22-14-12(4-2-6-19-14)20-15(23)13-10-21(8-7-18-13)16(24)11-3-1-5-17-9-11/h1,3,5,9,12-13,18H,2,4,6-8,10H2,(H,19,22)(H,20,23)/p+1/t12-,13-/m0/s1 |
| InChIKey | FZIOAHNPPKXAOH-STQMWFEESA-O |
| XLogP | -2.14 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |