C19H22N4O3S — CID 73147410
2-(3-cyanoanilino)-4,5-dihydroxy-N-methyl-N-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 73147410) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 2-(3-cyanoanilino)-4,5-dihydroxy-N-methyl-N-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | 2-(3-cyanoanilino)-4,5-dihydroxy-N-methyl-N-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 73147410 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-(3-cyanoanilino)-4,5-dihydroxy-N-methyl-N-prop-2-enyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | C=CCN(C)C(=O)C1CC(O)C(O)C2N=C(Nc3cccc(C#N)c3)SC12 |
| InChI | InChI=1S/C19H22N4O3S/c1-3-7-23(2)18(26)13-9-14(24)16(25)15-17(13)27-19(22-15)21-12-6-4-5-11(8-12)10-20/h3-6,8,13-17,24-25H,1,7,9H2,2H3,(H,21,22) |
| InChIKey | RDKZIEBVPFUACP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|