C23H22N4O3 — CID 7315697
4-[(2R,6S,7R)-4-(4-ethoxyphenyl)-3,5-dioxo-1,4,8-triazatricyclo[6.3.0.02,6]undecan-7-yl]benzonitrile (PubChem CID 7315697) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 4-[(2R,6S,7R)-4-(4-ethoxyphenyl)-3,5-dioxo-1,4,8-triazatricyclo[6.3.0.02,6]undecan-7-yl]benzonitrile.
| Compound Name | 4-[(2R,6S,7R)-4-(4-ethoxyphenyl)-3,5-dioxo-1,4,8-triazatricyclo[6.3.0.02,6]undecan-7-yl]benzonitrile |
|---|---|
| PubChem CID | 7315697 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 4-[(2R,6S,7R)-4-(4-ethoxyphenyl)-3,5-dioxo-1,4,8-triazatricyclo[6.3.0.02,6]undecan-7-yl]benzonitrile |
| SMILES | CCOc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)N2CCCN2[C@H]3c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C23H22N4O3/c1-2-30-18-10-8-17(9-11-18)27-22(28)19-20(16-6-4-15(14-24)5-7-16)25-12-3-13-26(25)21(19)23(27)29/h4-11,19-21H,2-3,12-13H2,1H3/t19-,20-,21+/m0/s1 |
| InChIKey | IKRWXNOKULEUCE-PCCBWWKXSA-N |
| XLogP | 2.49 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|