About 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione
8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione (PubChem CID 73166502) has the molecular formula C10H10NO4+
and a molecular weight of 208.19 g/mol. Its IUPAC name is 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione.
Molecular Properties
| Compound Name | 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione |
| PubChem CID | 73166502 |
| Molecular Formula | C10H10NO4+ |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione |
| SMILES | COC1C=CC=C2C(=O)OC(=O)[N+](C)=C21 |
| InChI | InChI=1S/C10H10NO4/c1-11-8-6(9(12)15-10(11)13)4-3-5-7(8)14-2/h3-5,7H,1-2H3/q+1 |
| InChIKey | NQNQKZCIHBFRKE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione?
The IUPAC name of 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione (CID 73166502) is 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione.
What is the SMILES notation for 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione?
The canonical SMILES for 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione is COC1C=CC=C2C(=O)OC(=O)[N+](C)=C21.
What is the InChIKey of 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione?
The InChIKey is NQNQKZCIHBFRKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10NO4/c1-11-8-6(9(12)15-10(11)13)4-3-5-7(8)14-2/h3-5,7H,1-2H3/q+1.
What are the key properties of 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione?
8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione has a molecular weight of 208.19 g/mol, XLogP of 0.26, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-1-methyl-8H-3,1-benzoxazin-1-ium-2,4-dione is sourced from PubChem (CID 73166502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).