C11H10NO3+ — CID 85439284
1-ethyl-8-methylidene-3,1-benzoxazin-1-ium-2,4-dione (PubChem CID 85439284) has the molecular formula C11H10NO3+ and a molecular weight of 204.20 g/mol. Its IUPAC name is 1-ethyl-8-methylidene-3,1-benzoxazin-1-ium-2,4-dione.
| Compound Name | 1-ethyl-8-methylidene-3,1-benzoxazin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 85439284 |
| Molecular Formula | C11H10NO3+ |
| Molecular Weight | 204.20 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 1-ethyl-8-methylidene-3,1-benzoxazin-1-ium-2,4-dione |
| SMILES | C=c1cccc2c1=[N+](CC)C(=O)OC2=O |
| InChI | InChI=1S/C11H10NO3/c1-3-12-9-7(2)5-4-6-8(9)10(13)15-11(12)14/h4-6H,2-3H2,1H3/q+1 |
| InChIKey | KYHNWBCUOMTRCE-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.20 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|