C11H9INO3+ — CID 75084639
6-iodo-1-prop-2-enyl-6H-3,1-benzoxazin-1-ium-2,4-dione (PubChem CID 75084639) has the molecular formula C11H9INO3+ and a molecular weight of 330.10 g/mol. Its IUPAC name is 6-iodo-1-prop-2-enyl-6H-3,1-benzoxazin-1-ium-2,4-dione.
| Compound Name | 6-iodo-1-prop-2-enyl-6H-3,1-benzoxazin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 75084639 |
| Molecular Formula | C11H9INO3+ |
| Molecular Weight | 330.10 g/mol |
| Exact Mass | 329.96 |
| IUPAC Name | 6-iodo-1-prop-2-enyl-6H-3,1-benzoxazin-1-ium-2,4-dione |
| SMILES | C=CC[N+]1=C2C=CC(I)C=C2C(=O)OC1=O |
| InChI | InChI=1S/C11H9INO3/c1-2-5-13-9-4-3-7(12)6-8(9)10(14)16-11(13)15/h2-4,6-7H,1,5H2/q+1 |
| InChIKey | KTFSQRAPOYPNLF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.10 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|