C12H12NO3+ — CID 73403258
6-methylidene-1-propyl-3,1-benzoxazin-1-ium-2,4-dione (PubChem CID 73403258) has the molecular formula C12H12NO3+ and a molecular weight of 218.23 g/mol. Its IUPAC name is 6-methylidene-1-propyl-3,1-benzoxazin-1-ium-2,4-dione.
| Compound Name | 6-methylidene-1-propyl-3,1-benzoxazin-1-ium-2,4-dione |
|---|---|
| PubChem CID | 73403258 |
| Molecular Formula | C12H12NO3+ |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 6-methylidene-1-propyl-3,1-benzoxazin-1-ium-2,4-dione |
| SMILES | C=c1ccc2c(c1)C(=O)OC(=O)[N+]=2CCC |
| InChI | InChI=1S/C12H12NO3/c1-3-6-13-10-5-4-8(2)7-9(10)11(14)16-12(13)15/h4-5,7H,2-3,6H2,1H3/q+1 |
| InChIKey | YVBOVXZUPSPATF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|