About ethyl 3-methoxyiminobutanoate
ethyl 3-methoxyiminobutanoate (PubChem CID 73185894) has the molecular formula C7H13NO3
and a molecular weight of 159.18 g/mol. Its IUPAC name is ethyl 3-methoxyiminobutanoate.
Molecular Properties
| Compound Name | ethyl 3-methoxyiminobutanoate |
| PubChem CID | 73185894 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | ethyl 3-methoxyiminobutanoate |
| SMILES | CCOC(=O)CC(C)=NOC |
| InChI | InChI=1S/C7H13NO3/c1-4-11-7(9)5-6(2)8-10-3/h4-5H2,1-3H3 |
| InChIKey | FWTDBKLRKKJIOG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-methoxyiminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methoxyiminobutanoate?
The IUPAC name of ethyl 3-methoxyiminobutanoate (CID 73185894) is ethyl 3-methoxyiminobutanoate.
What is the SMILES notation for ethyl 3-methoxyiminobutanoate?
The canonical SMILES for ethyl 3-methoxyiminobutanoate is CCOC(=O)CC(C)=NOC.
What is the InChIKey of ethyl 3-methoxyiminobutanoate?
The InChIKey is FWTDBKLRKKJIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-4-11-7(9)5-6(2)8-10-3/h4-5H2,1-3H3.
What are the key properties of ethyl 3-methoxyiminobutanoate?
ethyl 3-methoxyiminobutanoate has a molecular weight of 159.18 g/mol, XLogP of 0.96, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methoxyiminobutanoate is sourced from PubChem (CID 73185894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).