About 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one
3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 73202540) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one.
Molecular Properties
| Compound Name | 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| PubChem CID | 73202540 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | COC1=CC(C)(C)C2OC2C1=O |
| InChI | InChI=1S/C9H12O3/c1-9(2)4-5(11-3)6(10)7-8(9)12-7/h4,7-8H,1-3H3 |
| InChIKey | JQXZAMCOBBZVLZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one?
The IUPAC name of 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one (CID 73202540) is 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one.
What is the SMILES notation for 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one?
The canonical SMILES for 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one is COC1=CC(C)(C)C2OC2C1=O.
What is the InChIKey of 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one?
The InChIKey is JQXZAMCOBBZVLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-9(2)4-5(11-3)6(10)7-8(9)12-7/h4,7-8H,1-3H3.
What are the key properties of 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one?
3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one has a molecular weight of 168.19 g/mol, XLogP of 0.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one is sourced from PubChem (CID 73202540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).