C17H13BrClN3O — CID 73203007
N-[1-[1-(4-bromophenyl)-2-(2-chlorophenyl)imidazol-4-yl]ethylidene]hydroxylamine (PubChem CID 73203007) has the molecular formula C17H13BrClN3O and a molecular weight of 390.67 g/mol. Its IUPAC name is N-[1-[1-(4-bromophenyl)-2-(2-chlorophenyl)imidazol-4-yl]ethylidene]hydroxylamine.
| Compound Name | N-[1-[1-(4-bromophenyl)-2-(2-chlorophenyl)imidazol-4-yl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 73203007 |
| Molecular Formula | C17H13BrClN3O |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | N-[1-[1-(4-bromophenyl)-2-(2-chlorophenyl)imidazol-4-yl]ethylidene]hydroxylamine |
| SMILES | CC(=NO)c1cn(-c2ccc(Br)cc2)c(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C17H13BrClN3O/c1-11(21-23)16-10-22(13-8-6-12(18)7-9-13)17(20-16)14-4-2-3-5-15(14)19/h2-10,23H,1H3 |
| InChIKey | SNMUBIHIJVLJBP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|