C23H32N2O — CID 7320555
N-[(Z)-1-[(2S,3R)-2,3,8,8-tetramethyl-1,3,4,5,6,7-hexahydronaphthalen-2-yl]ethylideneamino]benzamide (PubChem CID 7320555) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is N-[(Z)-1-[(2S,3R)-2,3,8,8-tetramethyl-1,3,4,5,6,7-hexahydronaphthalen-2-yl]ethylideneamino]benzamide.
| Compound Name | N-[(Z)-1-[(2S,3R)-2,3,8,8-tetramethyl-1,3,4,5,6,7-hexahydronaphthalen-2-yl]ethylideneamino]benzamide |
|---|---|
| PubChem CID | 7320555 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | N-[(Z)-1-[(2S,3R)-2,3,8,8-tetramethyl-1,3,4,5,6,7-hexahydronaphthalen-2-yl]ethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccccc1)[C@@]1(C)CC2=C(CCCC2(C)C)C[C@H]1C |
| InChI | InChI=1S/C23H32N2O/c1-16-14-19-12-9-13-22(3,4)20(19)15-23(16,5)17(2)24-25-21(26)18-10-7-6-8-11-18/h6-8,10-11,16H,9,12-15H2,1-5H3,(H,25,26)/b24-17-/t16-,23+/m1/s1 |
| InChIKey | LJFIFYWCVHSVRF-HJNGVSFBSA-N |
| XLogP | 5.74 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|