C24H34N2O — CID 3837703
N-[1-(3,3,5,5-tetramethyl-1,2,4,6,7,8-hexahydronaphthalen-2-yl)propan-2-ylideneamino]benzamide (PubChem CID 3837703) has the molecular formula C24H34N2O and a molecular weight of 366.55 g/mol. Its IUPAC name is N-[1-(3,3,5,5-tetramethyl-1,2,4,6,7,8-hexahydronaphthalen-2-yl)propan-2-ylideneamino]benzamide.
| Compound Name | N-[1-(3,3,5,5-tetramethyl-1,2,4,6,7,8-hexahydronaphthalen-2-yl)propan-2-ylideneamino]benzamide |
|---|---|
| PubChem CID | 3837703 |
| Molecular Formula | C24H34N2O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | N-[1-(3,3,5,5-tetramethyl-1,2,4,6,7,8-hexahydronaphthalen-2-yl)propan-2-ylideneamino]benzamide |
| SMILES | CC(CC1CC2=C(CC1(C)C)C(C)(C)CCC2)=NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H34N2O/c1-17(25-26-22(27)18-10-7-6-8-11-18)14-20-15-19-12-9-13-23(2,3)21(19)16-24(20,4)5/h6-8,10-11,20H,9,12-16H2,1-5H3,(H,26,27) |
| InChIKey | CEEKIVXITQUMRQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|