C20H22O9 — CID 73212478
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(10R)-5,7,10-trihydroxy-9,10-dihydrophenanthren-4-yl]oxy]oxane-3,4,5-triol (PubChem CID 73212478) has the molecular formula C20H22O9 and a molecular weight of 406.39 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(10R)-5,7,10-trihydroxy-9,10-dihydrophenanthren-4-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(10R)-5,7,10-trihydroxy-9,10-dihydrophenanthren-4-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 73212478 |
| Molecular Formula | C20H22O9 |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(10R)-5,7,10-trihydroxy-9,10-dihydrophenanthren-4-yl]oxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Oc2cccc3c2-c2c(O)cc(O)cc2C[C@H]3O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H22O9/c21-7-14-17(25)18(26)19(27)20(29-14)28-13-3-1-2-10-11(23)5-8-4-9(22)6-12(24)15(8)16(10)13/h1-4,6,11,14,17-27H,5,7H2/t11-,14-,17-,18+,19-,20-/m1/s1 |
| InChIKey | MCMLGCMLBJFWHN-JTADLJFLSA-N |
| XLogP | -0.47 |
| TPSA | 160.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |