C22H22O11 — CID 71027937
3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-naphthalen-1-one (PubChem CID 71027937) has the molecular formula C22H22O11 and a molecular weight of 462.41 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-naphthalen-1-one.
| Compound Name | 3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 71027937 |
| Molecular Formula | C22H22O11 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-2-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-naphthalen-1-one |
| SMILES | O=C1C(OC2OC(CO)C(O)C(O)C2O)=C(c2ccc(O)c(O)c2)Cc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C22H22O11/c23-7-15-17(28)19(30)20(31)22(32-15)33-21-11(8-1-2-12(25)13(26)5-8)4-9-3-10(24)6-14(27)16(9)18(21)29/h1-3,5-6,15,17,19-20,22-28,30-31H,4,7H2 |
| InChIKey | IAZZHIDTQGYBOW-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 197.37 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|