C23H24O10 — CID 59848183
2-[3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxy-3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-4H-naphthalen-1-one (PubChem CID 59848183) has the molecular formula C23H24O10 and a molecular weight of 460.44 g/mol. Its IUPAC name is 2-[3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxy-3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-4H-naphthalen-1-one.
| Compound Name | 2-[3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxy-3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-4H-naphthalen-1-one |
|---|---|
| PubChem CID | 59848183 |
| Molecular Formula | C23H24O10 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 2-[3,4-dihydroxy-6-(hydroxymethyl)-5-methyloxan-2-yl]oxy-3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-4H-naphthalen-1-one |
| SMILES | CC1C(CO)OC(OC2=C(c3ccc(O)c(O)c3)Cc3cc(O)cc(O)c3C2=O)C(O)C1O |
| InChI | InChI=1S/C23H24O10/c1-9-17(8-24)32-23(21(31)19(9)29)33-22-13(10-2-3-14(26)15(27)6-10)5-11-4-12(25)7-16(28)18(11)20(22)30/h2-4,6-7,9,17,19,21,23-29,31H,5,8H2,1H3 |
| InChIKey | FZCRYMXHPCVOGW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|