C25H29NO8 — CID 143806339
tert-butyl N-[4-[[3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-1-oxo-4H-naphthalen-2-yl]oxy]butyl]carbamate (PubChem CID 143806339) has the molecular formula C25H29NO8 and a molecular weight of 471.51 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-1-oxo-4H-naphthalen-2-yl]oxy]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[[3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-1-oxo-4H-naphthalen-2-yl]oxy]butyl]carbamate |
|---|---|
| PubChem CID | 143806339 |
| Molecular Formula | C25H29NO8 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | tert-butyl N-[4-[[3-(3,4-dihydroxyphenyl)-6,8-dihydroxy-1-oxo-4H-naphthalen-2-yl]oxy]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCOC1=C(c2ccc(O)c(O)c2)Cc2cc(O)cc(O)c2C1=O |
| InChI | InChI=1S/C25H29NO8/c1-25(2,3)34-24(32)26-8-4-5-9-33-23-17(14-6-7-18(28)19(29)12-14)11-15-10-16(27)13-20(30)21(15)22(23)31/h6-7,10,12-13,27-30H,4-5,8-9,11H2,1-3H3,(H,26,32) |
| InChIKey | KJVOLTNPSYWBGD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|